C22H32O6 — CID 129290014
[(1R,9S,10S,12R)-1,9-dihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl] acetate (PubChem CID 129290014) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is [(1R,9S,10S,12R)-1,9-dihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl] acetate.
| Compound Name | [(1R,9S,10S,12R)-1,9-dihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl] acetate |
|---|---|
| PubChem CID | 129290014 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | [(1R,9S,10S,12R)-1,9-dihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl] acetate |
| SMILES | CC(=O)O[C@H]1C(=O)[C@@]2(C)C(C[C@]3(O)CCC(C)=C1C3(C)C)C1COC1C[C@@H]2O |
| InChI | InChI=1S/C22H32O6/c1-11-6-7-22(26)9-14-13-10-27-15(13)8-16(24)21(14,5)19(25)18(28-12(2)23)17(11)20(22,3)4/h13-16,18,24,26H,6-10H2,1-5H3/t13?,14?,15?,16-,18+,21-,22+/m0/s1 |
| InChIKey | OMLZEJLSZLPLPX-YXPBPRBASA-N |
| XLogP | 2.16 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|