C27H38O5 — CID 167092396
[(4R,12S,14R)-11-hydroxy-12,16,19,19-tetramethyl-1-[(2S)-oxiran-2-yl]-13-oxo-14-pentacyclo[13.3.1.03,12.04,9.06,8]nonadec-15-enyl] acetate (PubChem CID 167092396) has the molecular formula C27H38O5 and a molecular weight of 442.60 g/mol. Its IUPAC name is [(4R,12S,14R)-11-hydroxy-12,16,19,19-tetramethyl-1-[(2S)-oxiran-2-yl]-13-oxo-14-pentacyclo[13.3.1.03,12.04,9.06,8]nonadec-15-enyl] acetate.
| Compound Name | [(4R,12S,14R)-11-hydroxy-12,16,19,19-tetramethyl-1-[(2S)-oxiran-2-yl]-13-oxo-14-pentacyclo[13.3.1.03,12.04,9.06,8]nonadec-15-enyl] acetate |
|---|---|
| PubChem CID | 167092396 |
| Molecular Formula | C27H38O5 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | [(4R,12S,14R)-11-hydroxy-12,16,19,19-tetramethyl-1-[(2S)-oxiran-2-yl]-13-oxo-14-pentacyclo[13.3.1.03,12.04,9.06,8]nonadec-15-enyl] acetate |
| SMILES | CC(=O)O[C@H]1C(=O)[C@]2(C)C(O)CC3C4CC4C[C@H]3C2CC2(C3CO3)CCC(C)=C1C2(C)C |
| InChI | InChI=1S/C27H38O5/c1-13-6-7-27(21-12-31-21)11-19-18-9-15-8-16(15)17(18)10-20(29)26(19,5)24(30)23(32-14(2)28)22(13)25(27,3)4/h15-21,23,29H,6-12H2,1-5H3/t15?,16?,17?,18-,19?,20?,21?,23-,26+,27?/m1/s1 |
| InChIKey | YZDHGODYYYKNBQ-YHIJXWPASA-N |
| XLogP | 4.07 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|