C20H30O5 — CID 146420222
(7R,10S)-1,9,12-trihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one (PubChem CID 146420222) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (7R,10S)-1,9,12-trihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one.
| Compound Name | (7R,10S)-1,9,12-trihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
|---|---|
| PubChem CID | 146420222 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (7R,10S)-1,9,12-trihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
| SMILES | CC1=C2C(O)C(=O)[C@]3(C)C(O)C[C@H]4OCC4C3CC(O)(CC1)C2(C)C |
| InChI | InChI=1S/C20H30O5/c1-10-5-6-20(24)8-12-11-9-25-13(11)7-14(21)19(12,4)17(23)16(22)15(10)18(20,2)3/h11-14,16,21-22,24H,5-9H2,1-4H3/t11?,12?,13-,14?,16?,19+,20?/m1/s1 |
| InChIKey | DDPXVLLZXBYYLR-KNOSODPRSA-N |
| XLogP | 1.59 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|