C20H30O8 — CID 163969001
(1S,4S,7R,9S,10S,12R,15S)-1,4,9,12,15-pentahydroxy-17-(hydroxymethyl)-10,14,17-trimethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one (PubChem CID 163969001) has the molecular formula C20H30O8 and a molecular weight of 398.45 g/mol. Its IUPAC name is (1S,4S,7R,9S,10S,12R,15S)-1,4,9,12,15-pentahydroxy-17-(hydroxymethyl)-10,14,17-trimethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one.
| Compound Name | (1S,4S,7R,9S,10S,12R,15S)-1,4,9,12,15-pentahydroxy-17-(hydroxymethyl)-10,14,17-trimethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
|---|---|
| PubChem CID | 163969001 |
| Molecular Formula | C20H30O8 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | (1S,4S,7R,9S,10S,12R,15S)-1,4,9,12,15-pentahydroxy-17-(hydroxymethyl)-10,14,17-trimethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
| SMILES | CC1=C2[C@@H](O)C(=O)[C@@]3(C)C(C[C@](O)(C[C@@H]1O)C2(C)CO)[C@]1(O)CO[C@@H]1C[C@@H]3O |
| InChI | InChI=1S/C20H30O8/c1-9-10(22)5-19(26)6-11-18(3,12(23)4-13-20(11,27)8-28-13)16(25)15(24)14(9)17(19,2)7-21/h10-13,15,21-24,26-27H,4-8H2,1-3H3/t10-,11?,12-,13+,15+,17?,18-,19+,20+/m0/s1 |
| InChIKey | SOIQPESRWLTLDL-MSDVNEIMSA-N |
| XLogP | -1.35 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|