C24H36O7 — CID 126635897
[(1R,3S,4S,7R,9S,10S,12R)-1-hydroxy-9,12-dimethoxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate (PubChem CID 126635897) has the molecular formula C24H36O7 and a molecular weight of 436.55 g/mol. Its IUPAC name is [(1R,3S,4S,7R,9S,10S,12R)-1-hydroxy-9,12-dimethoxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate.
| Compound Name | [(1R,3S,4S,7R,9S,10S,12R)-1-hydroxy-9,12-dimethoxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate |
|---|---|
| PubChem CID | 126635897 |
| Molecular Formula | C24H36O7 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | [(1R,3S,4S,7R,9S,10S,12R)-1-hydroxy-9,12-dimethoxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate |
| SMILES | CO[C@H]1C(=O)[C@]2(C)[C@@H](OC)C[C@H]3OC[C@@]3(OC(C)=O)[C@H]2C[C@]2(O)CCC(C)=C1C2(C)C |
| InChI | InChI=1S/C24H36O7/c1-13-8-9-23(27)11-15-22(5,20(26)19(29-7)18(13)21(23,3)4)16(28-6)10-17-24(15,12-30-17)31-14(2)25/h15-17,19,27H,8-12H2,1-7H3/t15-,16-,17+,19+,22-,23+,24+/m0/s1 |
| InChIKey | DDFXDKJBISVAPX-UYJODNLUSA-N |
| XLogP | 2.58 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|