C23H36O4 — CID 145468372
[(1R,4S,7R,9S,10R)-1-hydroxy-9,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate (PubChem CID 145468372) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is [(1R,4S,7R,9S,10R)-1-hydroxy-9,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate.
| Compound Name | [(1R,4S,7R,9S,10R)-1-hydroxy-9,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate |
|---|---|
| PubChem CID | 145468372 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | [(1R,4S,7R,9S,10R)-1-hydroxy-9,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate |
| SMILES | CC(=O)O[C@@]12CO[C@@H]1C[C@H](C)[C@@]1(C)CCC3=C(C)CC[C@@](O)(CC12)C3(C)C |
| InChI | InChI=1S/C23H36O4/c1-14-7-10-22(25)12-18-21(6,9-8-17(14)20(22,4)5)15(2)11-19-23(18,13-26-19)27-16(3)24/h15,18-19,25H,7-13H2,1-6H3/t15-,18?,19+,21+,22+,23+/m0/s1 |
| InChIKey | SZRPWJFARJTRBP-KZIJROKZSA-N |
| XLogP | 4.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|