C29H44O6Si — CID 59111643
[(1R,5S,6S,7S,10R,12S,13R,15R,18S)-12,13,15,17,20,20-hexamethyl-3,14-dioxo-18-trimethylsilyl-2,9-dioxapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-7-yl] acetate (PubChem CID 59111643) has the molecular formula C29H44O6Si and a molecular weight of 516.75 g/mol. Its IUPAC name is [(1R,5S,6S,7S,10R,12S,13R,15R,18S)-12,13,15,17,20,20-hexamethyl-3,14-dioxo-18-trimethylsilyl-2,9-dioxapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-7-yl] acetate.
| Compound Name | [(1R,5S,6S,7S,10R,12S,13R,15R,18S)-12,13,15,17,20,20-hexamethyl-3,14-dioxo-18-trimethylsilyl-2,9-dioxapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-7-yl] acetate |
|---|---|
| PubChem CID | 59111643 |
| Molecular Formula | C29H44O6Si |
| Molecular Weight | 516.75 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | [(1R,5S,6S,7S,10R,12S,13R,15R,18S)-12,13,15,17,20,20-hexamethyl-3,14-dioxo-18-trimethylsilyl-2,9-dioxapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-7-yl] acetate |
| SMILES | CC(=O)O[C@@]12CO[C@@H]1C[C@H](C)[C@@]1(C)C(=O)[C@H](C)C3=C(C)[C@@H]([Si](C)(C)C)C[C@]4(OC(=O)C[C@H]4[C@H]21)C3(C)C |
| InChI | InChI=1S/C29H44O6Si/c1-15-11-21-28(14-33-21,34-18(4)30)24-19-12-22(31)35-29(19)13-20(36(8,9)10)16(2)23(26(29,5)6)17(3)25(32)27(15,24)7/h15,17,19-21,24H,11-14H2,1-10H3/t15-,17+,19-,20-,21+,24-,27+,28-,29+/m0/s1 |
| InChIKey | VQMSTNGXQHUTEO-LHYQIUPLSA-N |
| XLogP | 5.32 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.75 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|