C21H32O5 — CID 167107145
(7R,10S,12R)-1,9,12-trihydroxy-7,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one (PubChem CID 167107145) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is (7R,10S,12R)-1,9,12-trihydroxy-7,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one.
| Compound Name | (7R,10S,12R)-1,9,12-trihydroxy-7,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
|---|---|
| PubChem CID | 167107145 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (7R,10S,12R)-1,9,12-trihydroxy-7,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
| SMILES | CC1=C2[C@@H](O)C(=O)[C@]3(C)C(O)C[C@@]4(C)OCC4C3CC(O)(CC1)C2(C)C |
| InChI | InChI=1S/C21H32O5/c1-11-6-7-21(25)8-12-13-10-26-19(13,4)9-14(22)20(12,5)17(24)16(23)15(11)18(21,2)3/h12-14,16,22-23,25H,6-10H2,1-5H3/t12?,13?,14?,16-,19-,20+,21?/m1/s1 |
| InChIKey | CYTYJHYVGMSLCK-ACVIKCHRSA-N |
| XLogP | 1.98 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|