C20H30O6 — CID 135018650
(1R,2R,3R,4S,7R,9S,10S,12R)-2,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one (PubChem CID 135018650) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is (1R,2R,3R,4S,7R,9S,10S,12R)-2,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one.
| Compound Name | (1R,2R,3R,4S,7R,9S,10S,12R)-2,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
|---|---|
| PubChem CID | 135018650 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | (1R,2R,3R,4S,7R,9S,10S,12R)-2,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
| SMILES | CC1=C2[C@@H](O)C(=O)[C@@]3(C)[C@H]([C@H](O)[C@H](CC1)C2(C)C)[C@]1(O)CO[C@@H]1C[C@@H]3O |
| InChI | InChI=1S/C20H30O6/c1-9-5-6-10-14(22)16-19(4,11(21)7-12-20(16,25)8-26-12)17(24)15(23)13(9)18(10,2)3/h10-12,14-16,21-23,25H,5-8H2,1-4H3/t10-,11-,12+,14+,15+,16-,19+,20-/m0/s1 |
| InChIKey | VTBBCGCYDHCKAM-FOZYPTPUSA-N |
| XLogP | 0.56 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|