C36H42O8 — CID 146420262
[(1S,15S)-1,12-dihydroxy-10,14,17,17-tetramethyl-11-oxo-15-(3-phenylpropanoyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-9-yl] benzoate (PubChem CID 146420262) has the molecular formula C36H42O8 and a molecular weight of 602.72 g/mol. Its IUPAC name is [(1S,15S)-1,12-dihydroxy-10,14,17,17-tetramethyl-11-oxo-15-(3-phenylpropanoyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-9-yl] benzoate.
| Compound Name | [(1S,15S)-1,12-dihydroxy-10,14,17,17-tetramethyl-11-oxo-15-(3-phenylpropanoyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-9-yl] benzoate |
|---|---|
| PubChem CID | 146420262 |
| Molecular Formula | C36H42O8 |
| Molecular Weight | 602.72 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | [(1S,15S)-1,12-dihydroxy-10,14,17,17-tetramethyl-11-oxo-15-(3-phenylpropanoyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-9-yl] benzoate |
| SMILES | CC1=C2C(O)C(=O)C3(C)C(OC(=O)c4ccccc4)CC4OCC4C3C[C@](O)(C[C@@H]1OC(=O)CCc1ccccc1)C2(C)C |
| InChI | InChI=1S/C36H42O8/c1-21-27(43-29(37)16-15-22-11-7-5-8-12-22)19-36(41)18-25-24-20-42-26(24)17-28(44-33(40)23-13-9-6-10-14-23)35(25,4)32(39)31(38)30(21)34(36,2)3/h5-14,24-28,31,38,41H,15-20H2,1-4H3/t24?,25?,26?,27-,28?,31?,35?,36-/m0/s1 |
| InChIKey | WBGCIIMVEMTWKL-CIZOQNOOSA-N |
| XLogP | 4.61 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.72 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|