C23H32O5 — CID 91464897
7-hydroxy-8,12,17-trimethyl-15-(3-oxobutan-2-yl)-4-oxapentacyclo[9.5.1.01,8.02,5.015,17]heptadecane-9,10-dione (PubChem CID 91464897) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is 7-hydroxy-8,12,17-trimethyl-15-(3-oxobutan-2-yl)-4-oxapentacyclo[9.5.1.01,8.02,5.015,17]heptadecane-9,10-dione.
| Compound Name | 7-hydroxy-8,12,17-trimethyl-15-(3-oxobutan-2-yl)-4-oxapentacyclo[9.5.1.01,8.02,5.015,17]heptadecane-9,10-dione |
|---|---|
| PubChem CID | 91464897 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 7-hydroxy-8,12,17-trimethyl-15-(3-oxobutan-2-yl)-4-oxapentacyclo[9.5.1.01,8.02,5.015,17]heptadecane-9,10-dione |
| SMILES | CC(=O)C(C)C12CCC(C)C3C(=O)C(=O)C4(C)C(O)CC5OCC5C4(C1)C32C |
| InChI | InChI=1S/C23H32O5/c1-11-6-7-22(12(2)13(3)24)10-23-14-9-28-15(14)8-16(25)20(23,4)19(27)18(26)17(11)21(22,23)5/h11-12,14-17,25H,6-10H2,1-5H3 |
| InChIKey | VCNADJAKLZPZDW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|