C21H30O4 — CID 123381688
1-hydroxy-2,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-8-ene-11,12-dione (PubChem CID 123381688) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-hydroxy-2,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-8-ene-11,12-dione.
| Compound Name | 1-hydroxy-2,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-8-ene-11,12-dione |
|---|---|
| PubChem CID | 123381688 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 1-hydroxy-2,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-8-ene-11,12-dione |
| SMILES | CC1CCC2(O)C(C)C3C4COC4C=CC3(C)C(=O)C(=O)C1C2(C)C |
| InChI | InChI=1S/C21H30O4/c1-11-6-9-21(24)12(2)16-13-10-25-14(13)7-8-20(16,5)18(23)17(22)15(11)19(21,3)4/h7-8,11-16,24H,6,9-10H2,1-5H3 |
| InChIKey | CUHZQMUIOUIQAH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|