C13H32O5Si2 — CID 123437532
6-(1,1-dimethoxyethylsilyl)hexyl-trimethoxysilane (PubChem CID 123437532) has the molecular formula C13H32O5Si2 and a molecular weight of 324.57 g/mol. Its IUPAC name is 6-(1,1-dimethoxyethylsilyl)hexyl-trimethoxysilane.
| Compound Name | 6-(1,1-dimethoxyethylsilyl)hexyl-trimethoxysilane |
|---|---|
| PubChem CID | 123437532 |
| Molecular Formula | C13H32O5Si2 |
| Molecular Weight | 324.57 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 6-(1,1-dimethoxyethylsilyl)hexyl-trimethoxysilane |
| SMILES | COC(C)(OC)[SiH2]CCCCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C13H32O5Si2/c1-13(14-2,15-3)19-11-9-7-8-10-12-20(16-4,17-5)18-6/h7-12,19H2,1-6H3 |
| InChIKey | IASJVLVZNFLHQO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.57 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|