C15H37NO3Si2 — CID 174617421
N-[3-[diethyl(methoxy)silyl]propyl]-3-(1,1-dimethoxyethylsilyl)propan-1-amine (PubChem CID 174617421) has the molecular formula C15H37NO3Si2 and a molecular weight of 335.64 g/mol. Its IUPAC name is N-[3-[diethyl(methoxy)silyl]propyl]-3-(1,1-dimethoxyethylsilyl)propan-1-amine.
| Compound Name | N-[3-[diethyl(methoxy)silyl]propyl]-3-(1,1-dimethoxyethylsilyl)propan-1-amine |
|---|---|
| PubChem CID | 174617421 |
| Molecular Formula | C15H37NO3Si2 |
| Molecular Weight | 335.64 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | N-[3-[diethyl(methoxy)silyl]propyl]-3-(1,1-dimethoxyethylsilyl)propan-1-amine |
| SMILES | CC[Si](CC)(CCCNCCC[SiH2]C(C)(OC)OC)OC |
| InChI | InChI=1S/C15H37NO3Si2/c1-7-21(8-2,19-6)14-10-12-16-11-9-13-20-15(3,17-4)18-5/h16H,7-14,20H2,1-6H3 |
| InChIKey | LFGFNMPCKZDQQR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.64 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|