C16H18N2O2 — CID 123437927
2-N-(2-ethenyl-3-methoxyphenyl)-3-methoxybenzene-1,2-diamine (PubChem CID 123437927) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-N-(2-ethenyl-3-methoxyphenyl)-3-methoxybenzene-1,2-diamine.
| Compound Name | 2-N-(2-ethenyl-3-methoxyphenyl)-3-methoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 123437927 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-N-(2-ethenyl-3-methoxyphenyl)-3-methoxybenzene-1,2-diamine |
| SMILES | C=Cc1c(Nc2c(N)cccc2OC)cccc1OC |
| InChI | InChI=1S/C16H18N2O2/c1-4-11-13(8-6-9-14(11)19-2)18-16-12(17)7-5-10-15(16)20-3/h4-10,18H,1,17H2,2-3H3 |
| InChIKey | BPDNVYAGCINLAY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|