C22H45N — CID 123439977
N,6-dimethyl-N-(4,6,6-trimethylheptan-2-yl)dec-3-en-1-amine (PubChem CID 123439977) has the molecular formula C22H45N and a molecular weight of 323.61 g/mol. Its IUPAC name is N,6-dimethyl-N-(4,6,6-trimethylheptan-2-yl)dec-3-en-1-amine.
| Compound Name | N,6-dimethyl-N-(4,6,6-trimethylheptan-2-yl)dec-3-en-1-amine |
|---|---|
| PubChem CID | 123439977 |
| Molecular Formula | C22H45N |
| Molecular Weight | 323.61 g/mol |
| Exact Mass | 323.36 |
| IUPAC Name | N,6-dimethyl-N-(4,6,6-trimethylheptan-2-yl)dec-3-en-1-amine |
| SMILES | CCCCC(C)CC=CCCN(C)C(C)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C22H45N/c1-9-10-14-19(2)15-12-11-13-16-23(8)21(4)17-20(3)18-22(5,6)7/h11-12,19-21H,9-10,13-18H2,1-8H3 |
| InChIKey | XHNSNHJFADMJKN-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.61 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|