C19H30O4 — CID 123449221
dibutyl 7,7-dimethylbicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate (PubChem CID 123449221) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is dibutyl 7,7-dimethylbicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate.
| Compound Name | dibutyl 7,7-dimethylbicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 123449221 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | dibutyl 7,7-dimethylbicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate |
| SMILES | CCCCOC(=O)C1=C(C(=O)OCCCC)C2CCC1C2(C)C |
| InChI | InChI=1S/C19H30O4/c1-5-7-11-22-17(20)15-13-9-10-14(19(13,3)4)16(15)18(21)23-12-8-6-2/h13-14H,5-12H2,1-4H3 |
| InChIKey | KDOLGIGDJOYPTB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|