C31H39BO2 — CID 123450383
4-bis(2,3,4,5,6-pentamethylphenyl)boranyl-3,5-dimethylbenzoic acid (PubChem CID 123450383) has the molecular formula C31H39BO2 and a molecular weight of 454.46 g/mol. Its IUPAC name is 4-bis(2,3,4,5,6-pentamethylphenyl)boranyl-3,5-dimethylbenzoic acid.
| Compound Name | 4-bis(2,3,4,5,6-pentamethylphenyl)boranyl-3,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 123450383 |
| Molecular Formula | C31H39BO2 |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | 4-bis(2,3,4,5,6-pentamethylphenyl)boranyl-3,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(C)c1B(c1c(C)c(C)c(C)c(C)c1C)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C31H39BO2/c1-15-13-27(31(33)34)14-16(2)28(15)32(29-23(9)19(5)17(3)20(6)24(29)10)30-25(11)21(7)18(4)22(8)26(30)12/h13-14H,1-12H3,(H,33,34) |
| InChIKey | KJLGXRSWYAIHPE-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|