C11H21N2O4+ — CID 123450868
[4-acetyloxy-7-(ethylamino)-2,7-dioxoheptan-3-yl]azanium (PubChem CID 123450868) has the molecular formula C11H21N2O4+ and a molecular weight of 245.30 g/mol. Its IUPAC name is [4-acetyloxy-7-(ethylamino)-2,7-dioxoheptan-3-yl]azanium.
| Compound Name | [4-acetyloxy-7-(ethylamino)-2,7-dioxoheptan-3-yl]azanium |
|---|---|
| PubChem CID | 123450868 |
| Molecular Formula | C11H21N2O4+ |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | [4-acetyloxy-7-(ethylamino)-2,7-dioxoheptan-3-yl]azanium |
| SMILES | CCNC(=O)CCC(OC(C)=O)C([NH3+])C(C)=O |
| InChI | InChI=1S/C11H20N2O4/c1-4-13-10(16)6-5-9(17-8(3)15)11(12)7(2)14/h9,11H,4-6,12H2,1-3H3,(H,13,16)/p+1 |
| InChIKey | XJQOXZYOCZTDCQ-UHFFFAOYSA-O |
| XLogP | -0.97 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |