C22H31NO4 — CID 123453665
1-(2,3-dihydroxy-6-methoxyimino-10,13-dimethyl-1,2,3,4,5,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl)ethanone (PubChem CID 123453665) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is 1-(2,3-dihydroxy-6-methoxyimino-10,13-dimethyl-1,2,3,4,5,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl)ethanone.
| Compound Name | 1-(2,3-dihydroxy-6-methoxyimino-10,13-dimethyl-1,2,3,4,5,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl)ethanone |
|---|---|
| PubChem CID | 123453665 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 1-(2,3-dihydroxy-6-methoxyimino-10,13-dimethyl-1,2,3,4,5,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl)ethanone |
| SMILES | CON=C1C=C2C3=CCC(C(C)=O)C3(C)CCC2C2(C)CC(O)C(O)CC12 |
| InChI | InChI=1S/C22H31NO4/c1-12(24)14-5-6-15-13-9-18(23-27-4)17-10-19(25)20(26)11-22(17,3)16(13)7-8-21(14,15)2/h6,9,14,16-17,19-20,25-26H,5,7-8,10-11H2,1-4H3 |
| InChIKey | IPGVAZKAQUXIMP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|