C24H38F2N2O3 — CID 138509868
(6E)-17-[1-(2,2-difluoroethylamino)ethyl]-6-methoxyimino-10,13-dimethyl-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2,3-diol (PubChem CID 138509868) has the molecular formula C24H38F2N2O3 and a molecular weight of 440.58 g/mol. Its IUPAC name is (6E)-17-[1-(2,2-difluoroethylamino)ethyl]-6-methoxyimino-10,13-dimethyl-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2,3-diol.
| Compound Name | (6E)-17-[1-(2,2-difluoroethylamino)ethyl]-6-methoxyimino-10,13-dimethyl-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2,3-diol |
|---|---|
| PubChem CID | 138509868 |
| Molecular Formula | C24H38F2N2O3 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | (6E)-17-[1-(2,2-difluoroethylamino)ethyl]-6-methoxyimino-10,13-dimethyl-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2,3-diol |
| SMILES | CO/N=C1\C=C2C(CCC3(C)C2CCC3C(C)NCC(F)F)C2(C)CC(O)C(O)CC12 |
| InChI | InChI=1S/C24H38F2N2O3/c1-13(27-12-22(25)26)15-5-6-16-14-9-19(28-31-4)18-10-20(29)21(30)11-24(18,3)17(14)7-8-23(15,16)2/h9,13,15-18,20-22,27,29-30H,5-8,10-12H2,1-4H3/b28-19+ |
| InChIKey | HAWVWZSEXZMMIK-TURZUDJPSA-N |
| XLogP | 3.75 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|