C29H40F2N2O6 — CID 123380654
N-(2,2-difluoroethyl)-N-[1-(2,3,14-trihydroxy-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl]furan-2-carboxamide (PubChem CID 123380654) has the molecular formula C29H40F2N2O6 and a molecular weight of 550.64 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-[1-(2,3,14-trihydroxy-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl]furan-2-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-N-[1-(2,3,14-trihydroxy-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 123380654 |
| Molecular Formula | C29H40F2N2O6 |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-[1-(2,3,14-trihydroxy-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl]furan-2-carboxamide |
| SMILES | CON=C1C=C2C(CCC3(C)C(C(C)N(CC(F)F)C(=O)c4ccco4)CCC23O)C2(C)CC(O)C(O)CC12 |
| InChI | InChI=1S/C29H40F2N2O6/c1-16(33(15-25(30)31)26(36)24-6-5-11-39-24)17-8-10-29(37)19-12-21(32-38-4)20-13-22(34)23(35)14-27(20,2)18(19)7-9-28(17,29)3/h5-6,11-12,16-18,20,22-23,25,34-35,37H,7-10,13-15H2,1-4H3 |
| InChIKey | OLHIPLONOQABFS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|