C30H43NO5S — CID 138511234
N-(2,2-dimethoxyethyl)-N-[1-[(14S)-14-hydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]thiophene-2-carboxamide (PubChem CID 138511234) has the molecular formula C30H43NO5S and a molecular weight of 529.74 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-[1-[(14S)-14-hydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]thiophene-2-carboxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N-[1-[(14S)-14-hydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 138511234 |
| Molecular Formula | C30H43NO5S |
| Molecular Weight | 529.74 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-[1-[(14S)-14-hydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]thiophene-2-carboxamide |
| SMILES | COC(CN(C(=O)c1cccs1)C(C)C1CC[C@@]2(O)C3=CC(=O)C4CCCCC4(C)C3CCC12C)OC |
| InChI | InChI=1S/C30H43NO5S/c1-19(31(18-26(35-4)36-5)27(33)25-10-8-16-37-25)20-12-15-30(34)23-17-24(32)22-9-6-7-13-28(22,2)21(23)11-14-29(20,30)3/h8,10,16-17,19-22,26,34H,6-7,9,11-15,18H2,1-5H3/t19?,20?,21?,22?,28?,29?,30-/m1/s1 |
| InChIKey | FMMPFBQLXXOGAZ-VPAKMFFJSA-N |
| XLogP | 5.46 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.74 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|