About 1-(2,4-dimethylpentyl)-1-ethyl-2,3-dimethylcyclobutane
1-(2,4-dimethylpentyl)-1-ethyl-2,3-dimethylcyclobutane (PubChem CID 123458596) has the molecular formula C15H30
and a molecular weight of 210.40 g/mol. Its IUPAC name is 1-(2,4-dimethylpentyl)-1-ethyl-2,3-dimethylcyclobutane.
Molecular Properties
| Compound Name | 1-(2,4-dimethylpentyl)-1-ethyl-2,3-dimethylcyclobutane |
| PubChem CID | 123458596 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | 1-(2,4-dimethylpentyl)-1-ethyl-2,3-dimethylcyclobutane |
| SMILES | CCC1(CC(C)CC(C)C)CC(C)C1C |
| InChI | InChI=1S/C15H30/c1-7-15(10-13(5)14(15)6)9-12(4)8-11(2)3/h11-14H,7-10H2,1-6H3 |
| InChIKey | UTBWHOYDVSVIGP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(2,4-dimethylpentyl)-1-ethyl-2,3-dimethylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dimethylpentyl)-1-ethyl-2,3-dimethylcyclobutane?
The IUPAC name of 1-(2,4-dimethylpentyl)-1-ethyl-2,3-dimethylcyclobutane (CID 123458596) is 1-(2,4-dimethylpentyl)-1-ethyl-2,3-dimethylcyclobutane.
What is the SMILES notation for 1-(2,4-dimethylpentyl)-1-ethyl-2,3-dimethylcyclobutane?
The canonical SMILES for 1-(2,4-dimethylpentyl)-1-ethyl-2,3-dimethylcyclobutane is CCC1(CC(C)CC(C)C)CC(C)C1C.
What is the InChIKey of 1-(2,4-dimethylpentyl)-1-ethyl-2,3-dimethylcyclobutane?
The InChIKey is UTBWHOYDVSVIGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30/c1-7-15(10-13(5)14(15)6)9-12(4)8-11(2)3/h11-14H,7-10H2,1-6H3.
What are the key properties of 1-(2,4-dimethylpentyl)-1-ethyl-2,3-dimethylcyclobutane?
1-(2,4-dimethylpentyl)-1-ethyl-2,3-dimethylcyclobutane has a molecular weight of 210.40 g/mol, XLogP of 5.13, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dimethylpentyl)-1-ethyl-2,3-dimethylcyclobutane is sourced from PubChem (CID 123458596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).