C12H23N2+ — CID 123459753
methyl-[2-methyl-1-(methylamino)hexa-1,4-dienyl]-propylideneazanium (PubChem CID 123459753) has the molecular formula C12H23N2+ and a molecular weight of 195.33 g/mol. Its IUPAC name is methyl-[2-methyl-1-(methylamino)hexa-1,4-dienyl]-propylideneazanium.
| Compound Name | methyl-[2-methyl-1-(methylamino)hexa-1,4-dienyl]-propylideneazanium |
|---|---|
| PubChem CID | 123459753 |
| Molecular Formula | C12H23N2+ |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.19 |
| IUPAC Name | methyl-[2-methyl-1-(methylamino)hexa-1,4-dienyl]-propylideneazanium |
| SMILES | CC=CCC(C)=C(NC)[N+](C)=CCC |
| InChI | InChI=1S/C12H23N2/c1-6-8-9-11(3)12(13-4)14(5)10-7-2/h6,8,10,13H,7,9H2,1-5H3/q+1 |
| InChIKey | YEUFTSHYUQDJPN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|