C17H32N2 — CID 145017821
(1Z,3E)-2-[(Z)-but-1-enyl]-1-[(Z)-ethylideneamino]-N,3-dimethylhepta-1,3-dien-1-amine;ethane (PubChem CID 145017821) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is (1Z,3E)-2-[(Z)-but-1-enyl]-1-[(Z)-ethylideneamino]-N,3-dimethylhepta-1,3-dien-1-amine;ethane.
| Compound Name | (1Z,3E)-2-[(Z)-but-1-enyl]-1-[(Z)-ethylideneamino]-N,3-dimethylhepta-1,3-dien-1-amine;ethane |
|---|---|
| PubChem CID | 145017821 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | (1Z,3E)-2-[(Z)-but-1-enyl]-1-[(Z)-ethylideneamino]-N,3-dimethylhepta-1,3-dien-1-amine;ethane |
| SMILES | C/C=N\C(NC)=C(\C=C/CC)C(/C)=C/CCC.CC |
| InChI | InChI=1S/C15H26N2.C2H6/c1-6-9-11-13(4)14(12-10-7-2)15(16-5)17-8-3;1-2/h8,10-12,16H,6-7,9H2,1-5H3;1-2H3/b12-10-,13-11+,15-14-,17-8-; |
| InChIKey | HAAFGOOJCPYGEI-NVLSIMPMSA-N |
| XLogP | 5.25 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|