C13H20N2 — CID 138480695
(3Z,6E)-7-(ethylideneamino)-N,6-dimethyl-2,5-dimethylidenehepta-3,6-dien-1-amine (PubChem CID 138480695) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (3Z,6E)-7-(ethylideneamino)-N,6-dimethyl-2,5-dimethylidenehepta-3,6-dien-1-amine.
| Compound Name | (3Z,6E)-7-(ethylideneamino)-N,6-dimethyl-2,5-dimethylidenehepta-3,6-dien-1-amine |
|---|---|
| PubChem CID | 138480695 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (3Z,6E)-7-(ethylideneamino)-N,6-dimethyl-2,5-dimethylidenehepta-3,6-dien-1-amine |
| SMILES | C=C(/C=C/C(=C)/C(C)=C/N=C/C)CNC |
| InChI | InChI=1S/C13H20N2/c1-6-15-10-13(4)12(3)8-7-11(2)9-14-5/h6-8,10,14H,2-3,9H2,1,4-5H3/b8-7-,13-10+,15-6+ |
| InChIKey | GLXDQNOVCFRRIR-NREHIBIGSA-N |
| XLogP | 2.87 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|