C18H23NO3 — CID 123460247
9-methoxy-17-methyl-7,19-dioxa-17-azapentacyclo[10.5.1.12,5.06,14.08,13]nonadeca-8,10,12-triene (PubChem CID 123460247) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 9-methoxy-17-methyl-7,19-dioxa-17-azapentacyclo[10.5.1.12,5.06,14.08,13]nonadeca-8,10,12-triene.
| Compound Name | 9-methoxy-17-methyl-7,19-dioxa-17-azapentacyclo[10.5.1.12,5.06,14.08,13]nonadeca-8,10,12-triene |
|---|---|
| PubChem CID | 123460247 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 9-methoxy-17-methyl-7,19-dioxa-17-azapentacyclo[10.5.1.12,5.06,14.08,13]nonadeca-8,10,12-triene |
| SMILES | COc1ccc2c3c1OC1C4CCC(O4)C(C2)N(C)CCC31 |
| InChI | InChI=1S/C18H23NO3/c1-19-8-7-11-16-10-3-4-14(20-2)18(16)22-17(11)15-6-5-13(21-15)12(19)9-10/h3-4,11-13,15,17H,5-9H2,1-2H3 |
| InChIKey | QITWFBRIMUAZPV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |