C9H8FN — CID 123462795
3-fluoro-1-isocyano-2,4-dimethylbenzene (PubChem CID 123462795) has the molecular formula C9H8FN and a molecular weight of 149.17 g/mol. Its IUPAC name is 3-fluoro-1-isocyano-2,4-dimethylbenzene.
| Compound Name | 3-fluoro-1-isocyano-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 123462795 |
| Molecular Formula | C9H8FN |
| Molecular Weight | 149.17 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 3-fluoro-1-isocyano-2,4-dimethylbenzene |
| SMILES | [C-]#[N+]c1ccc(C)c(F)c1C |
| InChI | InChI=1S/C9H8FN/c1-6-4-5-8(11-3)7(2)9(6)10/h4-5H,1-2H3 |
| InChIKey | XBQAKOYORLQQIK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|