C12H12F2S — CID 123463502
4-cyclopropyl-5,6-difluoro-3,4-dihydro-2H-thiochromene (PubChem CID 123463502) has the molecular formula C12H12F2S and a molecular weight of 226.29 g/mol. Its IUPAC name is 4-cyclopropyl-5,6-difluoro-3,4-dihydro-2H-thiochromene.
| Compound Name | 4-cyclopropyl-5,6-difluoro-3,4-dihydro-2H-thiochromene |
|---|---|
| PubChem CID | 123463502 |
| Molecular Formula | C12H12F2S |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 4-cyclopropyl-5,6-difluoro-3,4-dihydro-2H-thiochromene |
| SMILES | Fc1ccc2c(c1F)C(C1CC1)CCS2 |
| InChI | InChI=1S/C12H12F2S/c13-9-3-4-10-11(12(9)14)8(5-6-15-10)7-1-2-7/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | CDCHDFVQGICDBS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |