C9H7BrCl2S — CID 131137957
4-bromo-5,6-dichloro-3,4-dihydro-2H-thiochromene (PubChem CID 131137957) has the molecular formula C9H7BrCl2S and a molecular weight of 298.03 g/mol. Its IUPAC name is 4-bromo-5,6-dichloro-3,4-dihydro-2H-thiochromene.
| Compound Name | 4-bromo-5,6-dichloro-3,4-dihydro-2H-thiochromene |
|---|---|
| PubChem CID | 131137957 |
| Molecular Formula | C9H7BrCl2S |
| Molecular Weight | 298.03 g/mol |
| Exact Mass | 295.88 |
| IUPAC Name | 4-bromo-5,6-dichloro-3,4-dihydro-2H-thiochromene |
| SMILES | Clc1ccc2c(c1Cl)C(Br)CCS2 |
| InChI | InChI=1S/C9H7BrCl2S/c10-5-3-4-13-7-2-1-6(11)9(12)8(5)7/h1-2,5H,3-4H2 |
| InChIKey | AXZCBMZLGDPYHT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.03 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|