C9H9Cl2NS — CID 130820585
5,6-dichloro-1,2,3,4-tetrahydroquinoline-4-thiol (PubChem CID 130820585) has the molecular formula C9H9Cl2NS and a molecular weight of 234.15 g/mol. Its IUPAC name is 5,6-dichloro-1,2,3,4-tetrahydroquinoline-4-thiol.
| Compound Name | 5,6-dichloro-1,2,3,4-tetrahydroquinoline-4-thiol |
|---|---|
| PubChem CID | 130820585 |
| Molecular Formula | C9H9Cl2NS |
| Molecular Weight | 234.15 g/mol |
| Exact Mass | 232.98 |
| IUPAC Name | 5,6-dichloro-1,2,3,4-tetrahydroquinoline-4-thiol |
| SMILES | SC1CCNc2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C9H9Cl2NS/c10-5-1-2-6-8(9(5)11)7(13)3-4-12-6/h1-2,7,12-13H,3-4H2 |
| InChIKey | URPTWWGSEXHMQX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.15 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|