C9H8BrClFN — CID 130934699
4-bromo-5-chloro-6-fluoro-1,2,3,4-tetrahydroquinoline (PubChem CID 130934699) has the molecular formula C9H8BrClFN and a molecular weight of 264.52 g/mol. Its IUPAC name is 4-bromo-5-chloro-6-fluoro-1,2,3,4-tetrahydroquinoline.
| Compound Name | 4-bromo-5-chloro-6-fluoro-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 130934699 |
| Molecular Formula | C9H8BrClFN |
| Molecular Weight | 264.52 g/mol |
| Exact Mass | 262.95 |
| IUPAC Name | 4-bromo-5-chloro-6-fluoro-1,2,3,4-tetrahydroquinoline |
| SMILES | Fc1ccc2c(c1Cl)C(Br)CCN2 |
| InChI | InChI=1S/C9H8BrClFN/c10-5-3-4-13-7-2-1-6(12)9(11)8(5)7/h1-2,5,13H,3-4H2 |
| InChIKey | KIZWZXJXYYTWHL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|