C9H8BrCl2N — CID 130952502
4-bromo-5,7-dichloro-1,2,3,4-tetrahydroquinoline (PubChem CID 130952502) has the molecular formula C9H8BrCl2N and a molecular weight of 280.98 g/mol. Its IUPAC name is 4-bromo-5,7-dichloro-1,2,3,4-tetrahydroquinoline.
| Compound Name | 4-bromo-5,7-dichloro-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 130952502 |
| Molecular Formula | C9H8BrCl2N |
| Molecular Weight | 280.98 g/mol |
| Exact Mass | 278.92 |
| IUPAC Name | 4-bromo-5,7-dichloro-1,2,3,4-tetrahydroquinoline |
| SMILES | Clc1cc(Cl)c2c(c1)NCCC2Br |
| InChI | InChI=1S/C9H8BrCl2N/c10-6-1-2-13-8-4-5(11)3-7(12)9(6)8/h3-4,6,13H,1-2H2 |
| InChIKey | WLBLEXYKSNVLFX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.98 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|