C25H39N5 — CID 123467502
(3Z)-5-[[(2E,4E)-5-[[(2E)-5-methylnona-2,4-dien-2-yl]diazenyl]hexa-2,4-dien-2-yl]diazenyl]-N-propylhexa-3,5-dien-2-imine (PubChem CID 123467502) has the molecular formula C25H39N5 and a molecular weight of 409.62 g/mol. Its IUPAC name is (3Z)-5-[[(2E,4E)-5-[[(2E)-5-methylnona-2,4-dien-2-yl]diazenyl]hexa-2,4-dien-2-yl]diazenyl]-N-propylhexa-3,5-dien-2-imine.
| Compound Name | (3Z)-5-[[(2E,4E)-5-[[(2E)-5-methylnona-2,4-dien-2-yl]diazenyl]hexa-2,4-dien-2-yl]diazenyl]-N-propylhexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 123467502 |
| Molecular Formula | C25H39N5 |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.32 |
| IUPAC Name | (3Z)-5-[[(2E,4E)-5-[[(2E)-5-methylnona-2,4-dien-2-yl]diazenyl]hexa-2,4-dien-2-yl]diazenyl]-N-propylhexa-3,5-dien-2-imine |
| SMILES | C=C(/C=C\C(C)=N\CCC)/N=N/C(C)=C/C=C(C)/N=N/C(C)=C/C=C(C)CCCC |
| InChI | InChI=1S/C25H39N5/c1-9-11-12-20(3)13-14-22(5)27-29-24(7)17-18-25(8)30-28-23(6)16-15-21(4)26-19-10-2/h13-18H,6,9-12,19H2,1-5,7-8H3/b16-15-,20-13?,22-14+,24-17+,25-18+,26-21+,29-27+,30-28+ |
| InChIKey | GGICREAYQMPQTL-BHKRMJFUSA-N |
| XLogP | 8.68 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|