C18H24N2 — CID 142324125
(2Z,5E,7Z)-5-ethenyl-4-N-[(E)-2-ethenylbut-2-enyl]-2-N-methylidenenona-2,5,7-triene-2,4-diimine (PubChem CID 142324125) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is (2Z,5E,7Z)-5-ethenyl-4-N-[(E)-2-ethenylbut-2-enyl]-2-N-methylidenenona-2,5,7-triene-2,4-diimine.
| Compound Name | (2Z,5E,7Z)-5-ethenyl-4-N-[(E)-2-ethenylbut-2-enyl]-2-N-methylidenenona-2,5,7-triene-2,4-diimine |
|---|---|
| PubChem CID | 142324125 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | (2Z,5E,7Z)-5-ethenyl-4-N-[(E)-2-ethenylbut-2-enyl]-2-N-methylidenenona-2,5,7-triene-2,4-diimine |
| SMILES | C=C/C(=C\C)C/N=C(\C=C(\C)N=C)C(/C=C)=C/C=C\C |
| InChI | InChI=1S/C18H24N2/c1-7-11-12-17(10-4)18(13-15(5)19-6)20-14-16(8-2)9-3/h7-13H,2,4,6,14H2,1,3,5H3/b11-7-,15-13-,16-9+,17-12+,20-18+ |
| InChIKey | CBYWDNXNOOWKNA-NZNMBKTPSA-N |
| XLogP | 4.85 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|