C25H30FN5O3 — CID 123467632
N-[4-(2-aminoethylideneamino)butyl]-3-(2-fluoro-5-methoxyphenyl)-2-propan-2-yloxyquinoxaline-6-carboxamide (PubChem CID 123467632) has the molecular formula C25H30FN5O3 and a molecular weight of 467.55 g/mol. Its IUPAC name is N-[4-(2-aminoethylideneamino)butyl]-3-(2-fluoro-5-methoxyphenyl)-2-propan-2-yloxyquinoxaline-6-carboxamide.
| Compound Name | N-[4-(2-aminoethylideneamino)butyl]-3-(2-fluoro-5-methoxyphenyl)-2-propan-2-yloxyquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 123467632 |
| Molecular Formula | C25H30FN5O3 |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | N-[4-(2-aminoethylideneamino)butyl]-3-(2-fluoro-5-methoxyphenyl)-2-propan-2-yloxyquinoxaline-6-carboxamide |
| SMILES | COc1ccc(F)c(-c2nc3cc(C(=O)NCCCC/N=C/CN)ccc3nc2OC(C)C)c1 |
| InChI | InChI=1S/C25H30FN5O3/c1-16(2)34-25-23(19-15-18(33-3)7-8-20(19)26)30-22-14-17(6-9-21(22)31-25)24(32)29-12-5-4-11-28-13-10-27/h6-9,13-16H,4-5,10-12,27H2,1-3H3,(H,29,32)/b28-13+ |
| InChIKey | XZTZQHYCSWFFJM-XODNFHPESA-N |
| XLogP | 3.77 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|