C24H23NO4 — CID 123468850
[5-(5-methyl-1,2-oxazol-3-yl)-4-oxohex-5-en-3-yl] 2,2-diphenylacetate (PubChem CID 123468850) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is [5-(5-methyl-1,2-oxazol-3-yl)-4-oxohex-5-en-3-yl] 2,2-diphenylacetate.
| Compound Name | [5-(5-methyl-1,2-oxazol-3-yl)-4-oxohex-5-en-3-yl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 123468850 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | [5-(5-methyl-1,2-oxazol-3-yl)-4-oxohex-5-en-3-yl] 2,2-diphenylacetate |
| SMILES | C=C(C(=O)C(CC)OC(=O)C(c1ccccc1)c1ccccc1)c1cc(C)on1 |
| InChI | InChI=1S/C24H23NO4/c1-4-21(23(26)17(3)20-15-16(2)29-25-20)28-24(27)22(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-15,21-22H,3-4H2,1-2H3 |
| InChIKey | RCFOVXOYRMMVPC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|