C23H20N2O5 — CID 155149412
[3-(5-methyl-1,2-oxazol-3-yl)-2-oxobut-3-enyl] 2-benzamido-2-phenylacetate (PubChem CID 155149412) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is [3-(5-methyl-1,2-oxazol-3-yl)-2-oxobut-3-enyl] 2-benzamido-2-phenylacetate.
| Compound Name | [3-(5-methyl-1,2-oxazol-3-yl)-2-oxobut-3-enyl] 2-benzamido-2-phenylacetate |
|---|---|
| PubChem CID | 155149412 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [3-(5-methyl-1,2-oxazol-3-yl)-2-oxobut-3-enyl] 2-benzamido-2-phenylacetate |
| SMILES | C=C(C(=O)COC(=O)C(NC(=O)c1ccccc1)c1ccccc1)c1cc(C)on1 |
| InChI | InChI=1S/C23H20N2O5/c1-15-13-19(25-30-15)16(2)20(26)14-29-23(28)21(17-9-5-3-6-10-17)24-22(27)18-11-7-4-8-12-18/h3-13,21H,2,14H2,1H3,(H,24,27) |
| InChIKey | FLCWAXOSNXYUFF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|