C19H35NO12 — CID 123472208
3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-(2,3,4-trihydroxyhexylamino)propoxy]propanoic acid (PubChem CID 123472208) has the molecular formula C19H35NO12 and a molecular weight of 469.48 g/mol. Its IUPAC name is 3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-(2,3,4-trihydroxyhexylamino)propoxy]propanoic acid.
| Compound Name | 3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-(2,3,4-trihydroxyhexylamino)propoxy]propanoic acid |
|---|---|
| PubChem CID | 123472208 |
| Molecular Formula | C19H35NO12 |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-(2,3,4-trihydroxyhexylamino)propoxy]propanoic acid |
| SMILES | CCC(O)C(O)C(O)CNC(COCCC(=O)O)(COCCC(=O)O)COCCC(=O)O |
| InChI | InChI=1S/C19H35NO12/c1-2-13(21)18(29)14(22)9-20-19(10-30-6-3-15(23)24,11-31-7-4-16(25)26)12-32-8-5-17(27)28/h13-14,18,20-22,29H,2-12H2,1H3,(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | QJYPLSFWJVRENC-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 212.31 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|