About 3,3-dimethylpenta-1,4-diene-2-sulfonic acid
3,3-dimethylpenta-1,4-diene-2-sulfonic acid (PubChem CID 123475012) has the molecular formula C7H12O3S
and a molecular weight of 176.24 g/mol. Its IUPAC name is 3,3-dimethylpenta-1,4-diene-2-sulfonic acid.
Molecular Properties
| Compound Name | 3,3-dimethylpenta-1,4-diene-2-sulfonic acid |
| PubChem CID | 123475012 |
| Molecular Formula | C7H12O3S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | 3,3-dimethylpenta-1,4-diene-2-sulfonic acid |
| SMILES | C=CC(C)(C)C(=C)S(=O)(=O)O |
| InChI | InChI=1S/C7H12O3S/c1-5-7(3,4)6(2)11(8,9)10/h5H,1-2H2,3-4H3,(H,8,9,10) |
| InChIKey | OWLGOIPXVWVPSW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethylpenta-1,4-diene-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylpenta-1,4-diene-2-sulfonic acid?
The IUPAC name of 3,3-dimethylpenta-1,4-diene-2-sulfonic acid (CID 123475012) is 3,3-dimethylpenta-1,4-diene-2-sulfonic acid.
What is the SMILES notation for 3,3-dimethylpenta-1,4-diene-2-sulfonic acid?
The canonical SMILES for 3,3-dimethylpenta-1,4-diene-2-sulfonic acid is C=CC(C)(C)C(=C)S(=O)(=O)O.
What is the InChIKey of 3,3-dimethylpenta-1,4-diene-2-sulfonic acid?
The InChIKey is OWLGOIPXVWVPSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3S/c1-5-7(3,4)6(2)11(8,9)10/h5H,1-2H2,3-4H3,(H,8,9,10).
What are the key properties of 3,3-dimethylpenta-1,4-diene-2-sulfonic acid?
3,3-dimethylpenta-1,4-diene-2-sulfonic acid has a molecular weight of 176.24 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylpenta-1,4-diene-2-sulfonic acid is sourced from PubChem (CID 123475012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).