C13H15F3O3S — CID 123476100
1-[3-(methoxymethyl)cyclobutyl]sulfonyl-3-(trifluoromethyl)benzene (PubChem CID 123476100) has the molecular formula C13H15F3O3S and a molecular weight of 308.32 g/mol. Its IUPAC name is 1-[3-(methoxymethyl)cyclobutyl]sulfonyl-3-(trifluoromethyl)benzene.
| Compound Name | 1-[3-(methoxymethyl)cyclobutyl]sulfonyl-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 123476100 |
| Molecular Formula | C13H15F3O3S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1-[3-(methoxymethyl)cyclobutyl]sulfonyl-3-(trifluoromethyl)benzene |
| SMILES | COCC1CC(S(=O)(=O)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C13H15F3O3S/c1-19-8-9-5-12(6-9)20(17,18)11-4-2-3-10(7-11)13(14,15)16/h2-4,7,9,12H,5-6,8H2,1H3 |
| InChIKey | JLKVMICXEGUBHJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |