C21H40 — CID 123480041
1,2,3,4-tetramethyl-5-(2-methyl-3-propan-2-ylhept-1-en-4-yl)cyclohexane (PubChem CID 123480041) has the molecular formula C21H40 and a molecular weight of 292.55 g/mol. Its IUPAC name is 1,2,3,4-tetramethyl-5-(2-methyl-3-propan-2-ylhept-1-en-4-yl)cyclohexane.
| Compound Name | 1,2,3,4-tetramethyl-5-(2-methyl-3-propan-2-ylhept-1-en-4-yl)cyclohexane |
|---|---|
| PubChem CID | 123480041 |
| Molecular Formula | C21H40 |
| Molecular Weight | 292.55 g/mol |
| Exact Mass | 292.31 |
| IUPAC Name | 1,2,3,4-tetramethyl-5-(2-methyl-3-propan-2-ylhept-1-en-4-yl)cyclohexane |
| SMILES | C=C(C)C(C(C)C)C(CCC)C1CC(C)C(C)C(C)C1C |
| InChI | InChI=1S/C21H40/c1-10-11-19(21(13(2)3)14(4)5)20-12-15(6)16(7)17(8)18(20)9/h14-21H,2,10-12H2,1,3-9H3 |
| InChIKey | VMSIUBOEBFMVMU-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.55 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|