C18H17N2O4+ — CID 123480805
methyl 7'-hydroxy-1-methyl-2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridin-7-ium]-5-carboxylate (PubChem CID 123480805) has the molecular formula C18H17N2O4+ and a molecular weight of 325.34 g/mol. Its IUPAC name is methyl 7'-hydroxy-1-methyl-2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridin-7-ium]-5-carboxylate.
| Compound Name | methyl 7'-hydroxy-1-methyl-2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridin-7-ium]-5-carboxylate |
|---|---|
| PubChem CID | 123480805 |
| Molecular Formula | C18H17N2O4+ |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | methyl 7'-hydroxy-1-methyl-2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridin-7-ium]-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CC1(C(=O)Nc3c1ccc[n+]3O)C2C |
| InChI | InChI=1S/C18H16N2O4/c1-10-13-6-5-11(16(21)24-2)8-12(13)9-18(10)14-4-3-7-20(23)15(14)19-17(18)22/h3-8,10,23H,9H2,1-2H3/p+1 |
| InChIKey | BBGRIEQWRZLOBI-UHFFFAOYSA-O |
| XLogP | 1.55 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|