C26H32N4O4S — CID 123482551
N-methyl-4-[[3-methyl-1,1-dioxo-6-(3-phenylpropylamino)thiazinan-2-yl]methyl]-N-(1,3-oxazol-2-yl)benzamide (PubChem CID 123482551) has the molecular formula C26H32N4O4S and a molecular weight of 496.63 g/mol. Its IUPAC name is N-methyl-4-[[3-methyl-1,1-dioxo-6-(3-phenylpropylamino)thiazinan-2-yl]methyl]-N-(1,3-oxazol-2-yl)benzamide.
| Compound Name | N-methyl-4-[[3-methyl-1,1-dioxo-6-(3-phenylpropylamino)thiazinan-2-yl]methyl]-N-(1,3-oxazol-2-yl)benzamide |
|---|---|
| PubChem CID | 123482551 |
| Molecular Formula | C26H32N4O4S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | N-methyl-4-[[3-methyl-1,1-dioxo-6-(3-phenylpropylamino)thiazinan-2-yl]methyl]-N-(1,3-oxazol-2-yl)benzamide |
| SMILES | CC1CCC(NCCCc2ccccc2)S(=O)(=O)N1Cc1ccc(C(=O)N(C)c2ncco2)cc1 |
| InChI | InChI=1S/C26H32N4O4S/c1-20-10-15-24(27-16-6-9-21-7-4-3-5-8-21)35(32,33)30(20)19-22-11-13-23(14-12-22)25(31)29(2)26-28-17-18-34-26/h3-5,7-8,11-14,17-18,20,24,27H,6,9-10,15-16,19H2,1-2H3 |
| InChIKey | ICPCMPCSSWPZOR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|