C20H20N2O3 — CID 19030593
4-butyl-N-methyl-N-(4-oxo-3,1-benzoxazin-2-yl)benzamide (PubChem CID 19030593) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-butyl-N-methyl-N-(4-oxo-3,1-benzoxazin-2-yl)benzamide.
| Compound Name | 4-butyl-N-methyl-N-(4-oxo-3,1-benzoxazin-2-yl)benzamide |
|---|---|
| PubChem CID | 19030593 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 4-butyl-N-methyl-N-(4-oxo-3,1-benzoxazin-2-yl)benzamide |
| SMILES | CCCCc1ccc(C(=O)N(C)c2nc3ccccc3c(=O)o2)cc1 |
| InChI | InChI=1S/C20H20N2O3/c1-3-4-7-14-10-12-15(13-11-14)18(23)22(2)20-21-17-9-6-5-8-16(17)19(24)25-20/h5-6,8-13H,3-4,7H2,1-2H3 |
| InChIKey | VYRPDINXQAQGPN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |