C29H40N4O2 — CID 135542785
N-(6-aminohexyl)-4-hexyl-N-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]benzamide (PubChem CID 135542785) has the molecular formula C29H40N4O2 and a molecular weight of 476.67 g/mol. Its IUPAC name is N-(6-aminohexyl)-4-hexyl-N-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]benzamide.
| Compound Name | N-(6-aminohexyl)-4-hexyl-N-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 135542785 |
| Molecular Formula | C29H40N4O2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | N-(6-aminohexyl)-4-hexyl-N-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]benzamide |
| SMILES | CCCCCCc1ccc(C(=O)N(CCCCCCN)C(C)c2nc3ccccc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C29H40N4O2/c1-3-4-5-8-13-23-16-18-24(19-17-23)29(35)33(21-12-7-6-11-20-30)22(2)27-31-26-15-10-9-14-25(26)28(34)32-27/h9-10,14-19,22H,3-8,11-13,20-21,30H2,1-2H3,(H,31,32,34) |
| InChIKey | WNLVCMKFATUWNK-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|