C23H28ClN4O2+ — CID 135619400
6-[(3-chlorobenzoyl)-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]amino]hexylazanium (PubChem CID 135619400) has the molecular formula C23H28ClN4O2+ and a molecular weight of 427.96 g/mol. Its IUPAC name is 6-[(3-chlorobenzoyl)-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]amino]hexylazanium.
| Compound Name | 6-[(3-chlorobenzoyl)-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]amino]hexylazanium |
|---|---|
| PubChem CID | 135619400 |
| Molecular Formula | C23H28ClN4O2+ |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 6-[(3-chlorobenzoyl)-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]amino]hexylazanium |
| SMILES | C[C@@H](c1nc2ccccc2c(=O)[nH]1)N(CCCCCC[NH3+])C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H27ClN4O2/c1-16(21-26-20-12-5-4-11-19(20)22(29)27-21)28(14-7-3-2-6-13-25)23(30)17-9-8-10-18(24)15-17/h4-5,8-12,15-16H,2-3,6-7,13-14,25H2,1H3,(H,26,27,29)/p+1/t16-/m0/s1 |
| InChIKey | VLWUHYWNUACZKN-INIZCTEOSA-O |
| XLogP | 3.58 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|