C25H33N5O2 — CID 135449474
1-(6-aminohexyl)-3-(2,6-dimethylphenyl)-1-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]urea (PubChem CID 135449474) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 1-(6-aminohexyl)-3-(2,6-dimethylphenyl)-1-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]urea.
| Compound Name | 1-(6-aminohexyl)-3-(2,6-dimethylphenyl)-1-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 135449474 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 1-(6-aminohexyl)-3-(2,6-dimethylphenyl)-1-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]urea |
| SMILES | Cc1cccc(C)c1NC(=O)N(CCCCCCN)C(C)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C25H33N5O2/c1-17-11-10-12-18(2)22(17)28-25(32)30(16-9-5-4-8-15-26)19(3)23-27-21-14-7-6-13-20(21)24(31)29-23/h6-7,10-14,19H,4-5,8-9,15-16,26H2,1-3H3,(H,28,32)(H,27,29,31) |
| InChIKey | SBQGCASQFVBPJT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|