C27H31N5O2 — CID 135516976
1-(6-aminohexyl)-3-naphthalen-1-yl-1-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]urea (PubChem CID 135516976) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 1-(6-aminohexyl)-3-naphthalen-1-yl-1-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]urea.
| Compound Name | 1-(6-aminohexyl)-3-naphthalen-1-yl-1-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 135516976 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 1-(6-aminohexyl)-3-naphthalen-1-yl-1-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]urea |
| SMILES | CC(c1nc2ccccc2c(=O)[nH]1)N(CCCCCCN)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C27H31N5O2/c1-19(25-29-24-15-7-6-14-22(24)26(33)31-25)32(18-9-3-2-8-17-28)27(34)30-23-16-10-12-20-11-4-5-13-21(20)23/h4-7,10-16,19H,2-3,8-9,17-18,28H2,1H3,(H,30,34)(H,29,31,33) |
| InChIKey | PNJLYRKDXFMPPJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|